C9H19N3O3S — CID 105361578
3-[cyclopentylsulfonyl(methyl)amino]-N'-hydroxypropanimidamide (PubChem CID 105361578) has the molecular formula C9H19N3O3S and a molecular weight of 249.34 g/mol. Its IUPAC name is 3-[cyclopentylsulfonyl(methyl)amino]-N'-hydroxypropanimidamide.
| Compound Name | 3-[cyclopentylsulfonyl(methyl)amino]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 105361578 |
| Molecular Formula | C9H19N3O3S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 3-[cyclopentylsulfonyl(methyl)amino]-N'-hydroxypropanimidamide |
| SMILES | CN(CCC(N)=NO)S(=O)(=O)C1CCCC1 |
| InChI | InChI=1S/C9H19N3O3S/c1-12(7-6-9(10)11-13)16(14,15)8-4-2-3-5-8/h8,13H,2-7H2,1H3,(H2,10,11) |
| InChIKey | UNYKQAPNLKQGQW-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|