C13H24BrNO2S — CID 105361767
N-[1-(bromomethyl)-4-methylcyclohexyl]cyclopentanesulfonamide (PubChem CID 105361767) has the molecular formula C13H24BrNO2S and a molecular weight of 338.31 g/mol. Its IUPAC name is N-[1-(bromomethyl)-4-methylcyclohexyl]cyclopentanesulfonamide.
| Compound Name | N-[1-(bromomethyl)-4-methylcyclohexyl]cyclopentanesulfonamide |
|---|---|
| PubChem CID | 105361767 |
| Molecular Formula | C13H24BrNO2S |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | N-[1-(bromomethyl)-4-methylcyclohexyl]cyclopentanesulfonamide |
| SMILES | CC1CCC(CBr)(NS(=O)(=O)C2CCCC2)CC1 |
| InChI | InChI=1S/C13H24BrNO2S/c1-11-6-8-13(10-14,9-7-11)15-18(16,17)12-4-2-3-5-12/h11-12,15H,2-10H2,1H3 |
| InChIKey | HMZQNSJLUSQPHF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|