C15H20N4S — CID 105362612
5,6-diethyl-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)-1,2,4-triazin-3-amine (PubChem CID 105362612) has the molecular formula C15H20N4S and a molecular weight of 288.42 g/mol. Its IUPAC name is 5,6-diethyl-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)-1,2,4-triazin-3-amine.
| Compound Name | 5,6-diethyl-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 105362612 |
| Molecular Formula | C15H20N4S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 5,6-diethyl-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)-1,2,4-triazin-3-amine |
| SMILES | CCc1nnc(NC2CCCc3sccc32)nc1CC |
| InChI | InChI=1S/C15H20N4S/c1-3-11-12(4-2)18-19-15(16-11)17-13-6-5-7-14-10(13)8-9-20-14/h8-9,13H,3-7H2,1-2H3,(H,16,17,19) |
| InChIKey | KJLPEWMUIFGYLK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |