C9H14F2N4 — CID 105362760
N-(2,2-difluoroethyl)-5,6-diethyl-1,2,4-triazin-3-amine (PubChem CID 105362760) has the molecular formula C9H14F2N4 and a molecular weight of 216.23 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-5,6-diethyl-1,2,4-triazin-3-amine.
| Compound Name | N-(2,2-difluoroethyl)-5,6-diethyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 105362760 |
| Molecular Formula | C9H14F2N4 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | N-(2,2-difluoroethyl)-5,6-diethyl-1,2,4-triazin-3-amine |
| SMILES | CCc1nnc(NCC(F)F)nc1CC |
| InChI | InChI=1S/C9H14F2N4/c1-3-6-7(4-2)14-15-9(13-6)12-5-8(10)11/h8H,3-5H2,1-2H3,(H,12,13,15) |
| InChIKey | LDSSGYVKGYQJOH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |