C12H19F3N4 — CID 105362762
5,6-diethyl-N-(5,5,5-trifluoropentyl)-1,2,4-triazin-3-amine (PubChem CID 105362762) has the molecular formula C12H19F3N4 and a molecular weight of 276.31 g/mol. Its IUPAC name is 5,6-diethyl-N-(5,5,5-trifluoropentyl)-1,2,4-triazin-3-amine.
| Compound Name | 5,6-diethyl-N-(5,5,5-trifluoropentyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 105362762 |
| Molecular Formula | C12H19F3N4 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 5,6-diethyl-N-(5,5,5-trifluoropentyl)-1,2,4-triazin-3-amine |
| SMILES | CCc1nnc(NCCCCC(F)(F)F)nc1CC |
| InChI | InChI=1S/C12H19F3N4/c1-3-9-10(4-2)18-19-11(17-9)16-8-6-5-7-12(13,14)15/h3-8H2,1-2H3,(H,16,17,19) |
| InChIKey | BWBRUPWZHIDLNM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|