C13H22N4O — CID 105362864
5,6-diethyl-N-[1-(oxolan-3-yl)ethyl]-1,2,4-triazin-3-amine (PubChem CID 105362864) has the molecular formula C13H22N4O and a molecular weight of 250.35 g/mol. Its IUPAC name is 5,6-diethyl-N-[1-(oxolan-3-yl)ethyl]-1,2,4-triazin-3-amine.
| Compound Name | 5,6-diethyl-N-[1-(oxolan-3-yl)ethyl]-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 105362864 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 5,6-diethyl-N-[1-(oxolan-3-yl)ethyl]-1,2,4-triazin-3-amine |
| SMILES | CCc1nnc(NC(C)C2CCOC2)nc1CC |
| InChI | InChI=1S/C13H22N4O/c1-4-11-12(5-2)16-17-13(15-11)14-9(3)10-6-7-18-8-10/h9-10H,4-8H2,1-3H3,(H,14,15,17) |
| InChIKey | UQQAHPMVZNPQPZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |