C16H20N4O — CID 105363136
8-[(5,6-diethyl-1,2,4-triazin-3-yl)oxy]-1,2,3,4-tetrahydroquinoline (PubChem CID 105363136) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is 8-[(5,6-diethyl-1,2,4-triazin-3-yl)oxy]-1,2,3,4-tetrahydroquinoline.
| Compound Name | 8-[(5,6-diethyl-1,2,4-triazin-3-yl)oxy]-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 105363136 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 8-[(5,6-diethyl-1,2,4-triazin-3-yl)oxy]-1,2,3,4-tetrahydroquinoline |
| SMILES | CCc1nnc(Oc2cccc3c2NCCC3)nc1CC |
| InChI | InChI=1S/C16H20N4O/c1-3-12-13(4-2)19-20-16(18-12)21-14-9-5-7-11-8-6-10-17-15(11)14/h5,7,9,17H,3-4,6,8,10H2,1-2H3 |
| InChIKey | KHGGJCDBNWBILN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |