About 3-(4-bromopiperidin-1-yl)-5,6-diethyl-1,2,4-triazine
3-(4-bromopiperidin-1-yl)-5,6-diethyl-1,2,4-triazine (PubChem CID 105363434) has the molecular formula C12H19BrN4
and a molecular weight of 299.22 g/mol. Its IUPAC name is 3-(4-bromopiperidin-1-yl)-5,6-diethyl-1,2,4-triazine.
Molecular Properties
| Compound Name | 3-(4-bromopiperidin-1-yl)-5,6-diethyl-1,2,4-triazine |
| PubChem CID | 105363434 |
| Molecular Formula | C12H19BrN4 |
| Molecular Weight | 299.22 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 3-(4-bromopiperidin-1-yl)-5,6-diethyl-1,2,4-triazine |
| SMILES | CCc1nnc(N2CCC(Br)CC2)nc1CC |
| InChI | InChI=1S/C12H19BrN4/c1-3-10-11(4-2)15-16-12(14-10)17-7-5-9(13)6-8-17/h9H,3-8H2,1-2H3 |
| InChIKey | ROWWPGRBALXAFR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.22 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-bromopiperidin-1-yl)-5,6-diethyl-1,2,4-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromopiperidin-1-yl)-5,6-diethyl-1,2,4-triazine?
The IUPAC name of 3-(4-bromopiperidin-1-yl)-5,6-diethyl-1,2,4-triazine (CID 105363434) is 3-(4-bromopiperidin-1-yl)-5,6-diethyl-1,2,4-triazine.
What is the SMILES notation for 3-(4-bromopiperidin-1-yl)-5,6-diethyl-1,2,4-triazine?
The canonical SMILES for 3-(4-bromopiperidin-1-yl)-5,6-diethyl-1,2,4-triazine is CCc1nnc(N2CCC(Br)CC2)nc1CC.
What is the InChIKey of 3-(4-bromopiperidin-1-yl)-5,6-diethyl-1,2,4-triazine?
The InChIKey is ROWWPGRBALXAFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19BrN4/c1-3-10-11(4-2)15-16-12(14-10)17-7-5-9(13)6-8-17/h9H,3-8H2,1-2H3.
What are the key properties of 3-(4-bromopiperidin-1-yl)-5,6-diethyl-1,2,4-triazine?
3-(4-bromopiperidin-1-yl)-5,6-diethyl-1,2,4-triazine has a molecular weight of 299.22 g/mol, XLogP of 2.36, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromopiperidin-1-yl)-5,6-diethyl-1,2,4-triazine is sourced from PubChem (CID 105363434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).