About methyl 3-(5-formyl-2,4-dimethyl-1H-pyrrol-3-yl)propanoate
methyl 3-(5-formyl-2,4-dimethyl-1H-pyrrol-3-yl)propanoate (PubChem CID 10536383) has the molecular formula C11H15NO3
and a molecular weight of 209.24 g/mol. Its IUPAC name is methyl 3-(5-formyl-2,4-dimethyl-1H-pyrrol-3-yl)propanoate.
Molecular Properties
| Compound Name | methyl 3-(5-formyl-2,4-dimethyl-1H-pyrrol-3-yl)propanoate |
| PubChem CID | 10536383 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | methyl 3-(5-formyl-2,4-dimethyl-1H-pyrrol-3-yl)propanoate |
| SMILES | COC(=O)CCc1c(C)[nH]c(C=O)c1C |
| InChI | InChI=1S/C11H15NO3/c1-7-9(4-5-11(14)15-3)8(2)12-10(7)6-13/h6,12H,4-5H2,1-3H3 |
| InChIKey | ICSYWXKWNBYRGB-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(5-formyl-2,4-dimethyl-1H-pyrrol-3-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(5-formyl-2,4-dimethyl-1H-pyrrol-3-yl)propanoate?
The IUPAC name of methyl 3-(5-formyl-2,4-dimethyl-1H-pyrrol-3-yl)propanoate (CID 10536383) is methyl 3-(5-formyl-2,4-dimethyl-1H-pyrrol-3-yl)propanoate.
What is the SMILES notation for methyl 3-(5-formyl-2,4-dimethyl-1H-pyrrol-3-yl)propanoate?
The canonical SMILES for methyl 3-(5-formyl-2,4-dimethyl-1H-pyrrol-3-yl)propanoate is COC(=O)CCc1c(C)[nH]c(C=O)c1C.
What is the InChIKey of methyl 3-(5-formyl-2,4-dimethyl-1H-pyrrol-3-yl)propanoate?
The InChIKey is ICSYWXKWNBYRGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO3/c1-7-9(4-5-11(14)15-3)8(2)12-10(7)6-13/h6,12H,4-5H2,1-3H3.
What are the key properties of methyl 3-(5-formyl-2,4-dimethyl-1H-pyrrol-3-yl)propanoate?
methyl 3-(5-formyl-2,4-dimethyl-1H-pyrrol-3-yl)propanoate has a molecular weight of 209.24 g/mol, XLogP of 1.55, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(5-formyl-2,4-dimethyl-1H-pyrrol-3-yl)propanoate is sourced from PubChem (CID 10536383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).