C14H27N — CID 10536398
3-heptyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine (PubChem CID 10536398) has the molecular formula C14H27N and a molecular weight of 209.38 g/mol. Its IUPAC name is 3-heptyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine.
| Compound Name | 3-heptyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 10536398 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | 3-heptyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
| SMILES | CCCCCCCC1CCC2CCCN12 |
| InChI | InChI=1S/C14H27N/c1-2-3-4-5-6-8-13-10-11-14-9-7-12-15(13)14/h13-14H,2-12H2,1H3 |
| InChIKey | KMHNDFHTQJHNQI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|