C15H20N6 — CID 105364049
N-[2-methyl-5-(tetrazol-1-yl)phenyl]-1-azabicyclo[3.2.1]octan-4-amine (PubChem CID 105364049) has the molecular formula C15H20N6 and a molecular weight of 284.37 g/mol. Its IUPAC name is N-[2-methyl-5-(tetrazol-1-yl)phenyl]-1-azabicyclo[3.2.1]octan-4-amine.
| Compound Name | N-[2-methyl-5-(tetrazol-1-yl)phenyl]-1-azabicyclo[3.2.1]octan-4-amine |
|---|---|
| PubChem CID | 105364049 |
| Molecular Formula | C15H20N6 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | N-[2-methyl-5-(tetrazol-1-yl)phenyl]-1-azabicyclo[3.2.1]octan-4-amine |
| SMILES | Cc1ccc(-n2cnnn2)cc1NC1CCN2CCC1C2 |
| InChI | InChI=1S/C15H20N6/c1-11-2-3-13(21-10-16-18-19-21)8-15(11)17-14-5-7-20-6-4-12(14)9-20/h2-3,8,10,12,14,17H,4-7,9H2,1H3 |
| InChIKey | ZBWKIDFBDAEGMF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |