About 3,3-diphenylprop-2-en-1-ol
3,3-diphenylprop-2-en-1-ol (PubChem CID 10536431) has the molecular formula C15H14O
and a molecular weight of 210.28 g/mol. Its IUPAC name is 3,3-diphenylprop-2-en-1-ol.
Molecular Properties
| Compound Name | 3,3-diphenylprop-2-en-1-ol |
| PubChem CID | 10536431 |
| Molecular Formula | C15H14O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 3,3-diphenylprop-2-en-1-ol |
| SMILES | OCC=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H14O/c16-12-11-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-11,16H,12H2 |
| InChIKey | VDZJHCQPPWSRFX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,3-diphenylprop-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-diphenylprop-2-en-1-ol?
The IUPAC name of 3,3-diphenylprop-2-en-1-ol (CID 10536431) is 3,3-diphenylprop-2-en-1-ol.
What is the SMILES notation for 3,3-diphenylprop-2-en-1-ol?
The canonical SMILES for 3,3-diphenylprop-2-en-1-ol is OCC=C(c1ccccc1)c1ccccc1.
What is the InChIKey of 3,3-diphenylprop-2-en-1-ol?
The InChIKey is VDZJHCQPPWSRFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O/c16-12-11-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-11,16H,12H2.
What are the key properties of 3,3-diphenylprop-2-en-1-ol?
3,3-diphenylprop-2-en-1-ol has a molecular weight of 210.28 g/mol, XLogP of 3.11, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-diphenylprop-2-en-1-ol is sourced from PubChem (CID 10536431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).