C14H26O — CID 10536454
6-methyl-3,3-bis(prop-1-en-2-yl)heptan-1-ol (PubChem CID 10536454) has the molecular formula C14H26O and a molecular weight of 210.36 g/mol. Its IUPAC name is 6-methyl-3,3-bis(prop-1-en-2-yl)heptan-1-ol.
| Compound Name | 6-methyl-3,3-bis(prop-1-en-2-yl)heptan-1-ol |
|---|---|
| PubChem CID | 10536454 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | 6-methyl-3,3-bis(prop-1-en-2-yl)heptan-1-ol |
| SMILES | C=C(C)C(CCO)(CCC(C)C)C(=C)C |
| InChI | InChI=1S/C14H26O/c1-11(2)7-8-14(9-10-15,12(3)4)13(5)6/h11,15H,3,5,7-10H2,1-2,4,6H3 |
| InChIKey | DIYWSBOSZICDIB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|