About 4-(aminomethyl)-N-(2,2-difluoroethyl)-1-azabicyclo[3.2.1]octan-4-amine
4-(aminomethyl)-N-(2,2-difluoroethyl)-1-azabicyclo[3.2.1]octan-4-amine (PubChem CID 105365263) has the molecular formula C10H19F2N3
and a molecular weight of 219.28 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(2,2-difluoroethyl)-1-azabicyclo[3.2.1]octan-4-amine.
Molecular Properties
| Compound Name | 4-(aminomethyl)-N-(2,2-difluoroethyl)-1-azabicyclo[3.2.1]octan-4-amine |
| PubChem CID | 105365263 |
| Molecular Formula | C10H19F2N3 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 4-(aminomethyl)-N-(2,2-difluoroethyl)-1-azabicyclo[3.2.1]octan-4-amine |
| SMILES | NCC1(NCC(F)F)CCN2CCC1C2 |
| InChI | InChI=1S/C10H19F2N3/c11-9(12)5-14-10(7-13)2-4-15-3-1-8(10)6-15/h8-9,14H,1-7,13H2 |
| InChIKey | QFNUOLDGQDSIQI-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(aminomethyl)-N-(2,2-difluoroethyl)-1-azabicyclo[3.2.1]octan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)-N-(2,2-difluoroethyl)-1-azabicyclo[3.2.1]octan-4-amine?
The IUPAC name of 4-(aminomethyl)-N-(2,2-difluoroethyl)-1-azabicyclo[3.2.1]octan-4-amine (CID 105365263) is 4-(aminomethyl)-N-(2,2-difluoroethyl)-1-azabicyclo[3.2.1]octan-4-amine.
What is the SMILES notation for 4-(aminomethyl)-N-(2,2-difluoroethyl)-1-azabicyclo[3.2.1]octan-4-amine?
The canonical SMILES for 4-(aminomethyl)-N-(2,2-difluoroethyl)-1-azabicyclo[3.2.1]octan-4-amine is NCC1(NCC(F)F)CCN2CCC1C2.
What is the InChIKey of 4-(aminomethyl)-N-(2,2-difluoroethyl)-1-azabicyclo[3.2.1]octan-4-amine?
The InChIKey is QFNUOLDGQDSIQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F2N3/c11-9(12)5-14-10(7-13)2-4-15-3-1-8(10)6-15/h8-9,14H,1-7,13H2.
What are the key properties of 4-(aminomethyl)-N-(2,2-difluoroethyl)-1-azabicyclo[3.2.1]octan-4-amine?
4-(aminomethyl)-N-(2,2-difluoroethyl)-1-azabicyclo[3.2.1]octan-4-amine has a molecular weight of 219.28 g/mol, XLogP of 0.26, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)-N-(2,2-difluoroethyl)-1-azabicyclo[3.2.1]octan-4-amine is sourced from PubChem (CID 105365263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).