C12H24OSi — CID 10536527
3-[(1R,3S)-3-methylcyclopentyl]-1-trimethylsilylpropan-1-one (PubChem CID 10536527) has the molecular formula C12H24OSi and a molecular weight of 212.41 g/mol. Its IUPAC name is 3-[(1R,3S)-3-methylcyclopentyl]-1-trimethylsilylpropan-1-one.
| Compound Name | 3-[(1R,3S)-3-methylcyclopentyl]-1-trimethylsilylpropan-1-one |
|---|---|
| PubChem CID | 10536527 |
| Molecular Formula | C12H24OSi |
| Molecular Weight | 212.41 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 3-[(1R,3S)-3-methylcyclopentyl]-1-trimethylsilylpropan-1-one |
| SMILES | C[C@H]1CC[C@H](CCC(=O)[Si](C)(C)C)C1 |
| InChI | InChI=1S/C12H24OSi/c1-10-5-6-11(9-10)7-8-12(13)14(2,3)4/h10-11H,5-9H2,1-4H3/t10-,11+/m0/s1 |
| InChIKey | TYMQKRKZJIEYPI-WDEREUQCSA-N |
| XLogP | 3.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|