C13H18N2O2 — CID 105365838
4-(5-methoxy-3-pyridinyl)-1-azabicyclo[3.2.1]octan-4-ol (PubChem CID 105365838) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 4-(5-methoxy-3-pyridinyl)-1-azabicyclo[3.2.1]octan-4-ol.
| Compound Name | 4-(5-methoxy-3-pyridinyl)-1-azabicyclo[3.2.1]octan-4-ol |
|---|---|
| PubChem CID | 105365838 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 4-(5-methoxy-3-pyridinyl)-1-azabicyclo[3.2.1]octan-4-ol |
| SMILES | COc1cncc(C2(O)CCN3CCC2C3)c1 |
| InChI | InChI=1S/C13H18N2O2/c1-17-12-6-11(7-14-8-12)13(16)3-5-15-4-2-10(13)9-15/h6-8,10,16H,2-5,9H2,1H3 |
| InChIKey | NPUNJYRETQMFIE-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |