C10H17NO4 — CID 10536622
[(2S,3R,6R)-6-methyl-2-propan-2-yloxy-3,6-dihydro-2H-pyran-3-yl] carbamate (PubChem CID 10536622) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is [(2S,3R,6R)-6-methyl-2-propan-2-yloxy-3,6-dihydro-2H-pyran-3-yl] carbamate.
| Compound Name | [(2S,3R,6R)-6-methyl-2-propan-2-yloxy-3,6-dihydro-2H-pyran-3-yl] carbamate |
|---|---|
| PubChem CID | 10536622 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | [(2S,3R,6R)-6-methyl-2-propan-2-yloxy-3,6-dihydro-2H-pyran-3-yl] carbamate |
| SMILES | CC(C)O[C@H]1O[C@H](C)C=C[C@H]1OC(N)=O |
| InChI | InChI=1S/C10H17NO4/c1-6(2)13-9-8(15-10(11)12)5-4-7(3)14-9/h4-9H,1-3H3,(H2,11,12)/t7-,8-,9+/m1/s1 |
| InChIKey | CKEFFMTUPILIEJ-HLTSFMKQSA-N |
| XLogP | 1.18 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|