C13H22N2O2 — CID 105366228
2-[1-(1-azabicyclo[3.2.1]octan-4-yl)azetidin-3-yl]propanoic acid (PubChem CID 105366228) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 2-[1-(1-azabicyclo[3.2.1]octan-4-yl)azetidin-3-yl]propanoic acid.
| Compound Name | 2-[1-(1-azabicyclo[3.2.1]octan-4-yl)azetidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 105366228 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 2-[1-(1-azabicyclo[3.2.1]octan-4-yl)azetidin-3-yl]propanoic acid |
| SMILES | CC(C(=O)O)C1CN(C2CCN3CCC2C3)C1 |
| InChI | InChI=1S/C13H22N2O2/c1-9(13(16)17)11-7-15(8-11)12-3-5-14-4-2-10(12)6-14/h9-12H,2-8H2,1H3,(H,16,17) |
| InChIKey | NRSRZMBNIGZDSS-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |