C11H12BrN3O — CID 105366531
4-(3-bromo-5-methyl-2-pyridinyl)morpholine-2-carbonitrile (PubChem CID 105366531) has the molecular formula C11H12BrN3O and a molecular weight of 282.14 g/mol. Its IUPAC name is 4-(3-bromo-5-methyl-2-pyridinyl)morpholine-2-carbonitrile.
| Compound Name | 4-(3-bromo-5-methyl-2-pyridinyl)morpholine-2-carbonitrile |
|---|---|
| PubChem CID | 105366531 |
| Molecular Formula | C11H12BrN3O |
| Molecular Weight | 282.14 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | 4-(3-bromo-5-methyl-2-pyridinyl)morpholine-2-carbonitrile |
| SMILES | Cc1cnc(N2CCOC(C#N)C2)c(Br)c1 |
| InChI | InChI=1S/C11H12BrN3O/c1-8-4-10(12)11(14-6-8)15-2-3-16-9(5-13)7-15/h4,6,9H,2-3,7H2,1H3 |
| InChIKey | WKGIDWKXSCCAMZ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 49.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.14 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |