About 5-(3,4-dihydro-2H-chromen-2-ylmethyl)-4,5-dihydro-1H-imidazole
5-(3,4-dihydro-2H-chromen-2-ylmethyl)-4,5-dihydro-1H-imidazole (PubChem CID 10536695) has the molecular formula C13H16N2O
and a molecular weight of 216.28 g/mol. Its IUPAC name is 5-(3,4-dihydro-2H-chromen-2-ylmethyl)-4,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 5-(3,4-dihydro-2H-chromen-2-ylmethyl)-4,5-dihydro-1H-imidazole |
| PubChem CID | 10536695 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 5-(3,4-dihydro-2H-chromen-2-ylmethyl)-4,5-dihydro-1H-imidazole |
| SMILES | C1=NCC(CC2CCc3ccccc3O2)N1 |
| InChI | InChI=1S/C13H16N2O/c1-2-4-13-10(3-1)5-6-12(16-13)7-11-8-14-9-15-11/h1-4,9,11-12H,5-8H2,(H,14,15) |
| InChIKey | AGDPTWNZMXTMAR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(3,4-dihydro-2H-chromen-2-ylmethyl)-4,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-dihydro-2H-chromen-2-ylmethyl)-4,5-dihydro-1H-imidazole?
The IUPAC name of 5-(3,4-dihydro-2H-chromen-2-ylmethyl)-4,5-dihydro-1H-imidazole (CID 10536695) is 5-(3,4-dihydro-2H-chromen-2-ylmethyl)-4,5-dihydro-1H-imidazole.
What is the SMILES notation for 5-(3,4-dihydro-2H-chromen-2-ylmethyl)-4,5-dihydro-1H-imidazole?
The canonical SMILES for 5-(3,4-dihydro-2H-chromen-2-ylmethyl)-4,5-dihydro-1H-imidazole is C1=NCC(CC2CCc3ccccc3O2)N1.
What is the InChIKey of 5-(3,4-dihydro-2H-chromen-2-ylmethyl)-4,5-dihydro-1H-imidazole?
The InChIKey is AGDPTWNZMXTMAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O/c1-2-4-13-10(3-1)5-6-12(16-13)7-11-8-14-9-15-11/h1-4,9,11-12H,5-8H2,(H,14,15).
What are the key properties of 5-(3,4-dihydro-2H-chromen-2-ylmethyl)-4,5-dihydro-1H-imidazole?
5-(3,4-dihydro-2H-chromen-2-ylmethyl)-4,5-dihydro-1H-imidazole has a molecular weight of 216.28 g/mol, XLogP of 1.77, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dihydro-2H-chromen-2-ylmethyl)-4,5-dihydro-1H-imidazole is sourced from PubChem (CID 10536695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).