About methyl (3S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxybutanoate
methyl (3S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxybutanoate (PubChem CID 10536783) has the molecular formula C10H18O5
and a molecular weight of 218.25 g/mol. Its IUPAC name is methyl (3S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxybutanoate.
Molecular Properties
| Compound Name | methyl (3S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxybutanoate |
| PubChem CID | 10536783 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | methyl (3S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxybutanoate |
| SMILES | COC(=O)C[C@@H](O)C[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C10H18O5/c1-10(2)14-6-8(15-10)4-7(11)5-9(12)13-3/h7-8,11H,4-6H2,1-3H3/t7-,8-/m0/s1 |
| InChIKey | DWQVEBNRJGOPAY-YUMQZZPRSA-N |
| XLogP | 0.45 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl (3S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxybutanoate?
The IUPAC name of methyl (3S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxybutanoate (CID 10536783) is methyl (3S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxybutanoate.
What is the SMILES notation for methyl (3S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxybutanoate?
The canonical SMILES for methyl (3S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxybutanoate is COC(=O)C[C@@H](O)C[C@H]1COC(C)(C)O1.
What is the InChIKey of methyl (3S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxybutanoate?
The InChIKey is DWQVEBNRJGOPAY-YUMQZZPRSA-N. The full InChI is InChI=1S/C10H18O5/c1-10(2)14-6-8(15-10)4-7(11)5-9(12)13-3/h7-8,11H,4-6H2,1-3H3/t7-,8-/m0/s1.
What are the key properties of methyl (3S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxybutanoate?
methyl (3S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxybutanoate has a molecular weight of 218.25 g/mol, XLogP of 0.45, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxybutanoate is sourced from PubChem (CID 10536783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).