C14H22FNO — CID 105372347
N-ethyl-4-(5-fluoro-2-methylphenyl)-1-methoxybutan-2-amine (PubChem CID 105372347) has the molecular formula C14H22FNO and a molecular weight of 239.33 g/mol. Its IUPAC name is N-ethyl-4-(5-fluoro-2-methylphenyl)-1-methoxybutan-2-amine.
| Compound Name | N-ethyl-4-(5-fluoro-2-methylphenyl)-1-methoxybutan-2-amine |
|---|---|
| PubChem CID | 105372347 |
| Molecular Formula | C14H22FNO |
| Molecular Weight | 239.33 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | N-ethyl-4-(5-fluoro-2-methylphenyl)-1-methoxybutan-2-amine |
| SMILES | CCNC(CCc1cc(F)ccc1C)COC |
| InChI | InChI=1S/C14H22FNO/c1-4-16-14(10-17-3)8-6-12-9-13(15)7-5-11(12)2/h5,7,9,14,16H,4,6,8,10H2,1-3H3 |
| InChIKey | XEMJSXRNLKNUCA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |