C19H23FO — CID 105372779
1-(4-tert-butylphenyl)-2-(5-fluoro-2-methylphenyl)ethanol (PubChem CID 105372779) has the molecular formula C19H23FO and a molecular weight of 286.39 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-2-(5-fluoro-2-methylphenyl)ethanol.
| Compound Name | 1-(4-tert-butylphenyl)-2-(5-fluoro-2-methylphenyl)ethanol |
|---|---|
| PubChem CID | 105372779 |
| Molecular Formula | C19H23FO |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 1-(4-tert-butylphenyl)-2-(5-fluoro-2-methylphenyl)ethanol |
| SMILES | Cc1ccc(F)cc1CC(O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H23FO/c1-13-5-10-17(20)11-15(13)12-18(21)14-6-8-16(9-7-14)19(2,3)4/h5-11,18,21H,12H2,1-4H3 |
| InChIKey | SCMSAPTXUXLJNX-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |