C16H22FNO2 — CID 105373520
1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-2-(5-fluoro-2-methylphenyl)ethanol (PubChem CID 105373520) has the molecular formula C16H22FNO2 and a molecular weight of 279.36 g/mol. Its IUPAC name is 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-2-(5-fluoro-2-methylphenyl)ethanol.
| Compound Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-2-(5-fluoro-2-methylphenyl)ethanol |
|---|---|
| PubChem CID | 105373520 |
| Molecular Formula | C16H22FNO2 |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-2-(5-fluoro-2-methylphenyl)ethanol |
| SMILES | Cc1ccc(F)cc1CC(O)C1CN2CCCC2CO1 |
| InChI | InChI=1S/C16H22FNO2/c1-11-4-5-13(17)7-12(11)8-15(19)16-9-18-6-2-3-14(18)10-20-16/h4-5,7,14-16,19H,2-3,6,8-10H2,1H3 |
| InChIKey | VMVWSKLMEBZPSN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |