C17H20FN — CID 105373660
2-(5-fluoro-2-methylphenyl)-N-methyl-1-(4-methylphenyl)ethanamine (PubChem CID 105373660) has the molecular formula C17H20FN and a molecular weight of 257.35 g/mol. Its IUPAC name is 2-(5-fluoro-2-methylphenyl)-N-methyl-1-(4-methylphenyl)ethanamine.
| Compound Name | 2-(5-fluoro-2-methylphenyl)-N-methyl-1-(4-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 105373660 |
| Molecular Formula | C17H20FN |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 2-(5-fluoro-2-methylphenyl)-N-methyl-1-(4-methylphenyl)ethanamine |
| SMILES | CNC(Cc1cc(F)ccc1C)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H20FN/c1-12-4-7-14(8-5-12)17(19-3)11-15-10-16(18)9-6-13(15)2/h4-10,17,19H,11H2,1-3H3 |
| InChIKey | WDIYEYVZTCMJRX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |