C17H22FNS — CID 105373823
1-(5-fluoro-2-methylphenyl)-N-propyl-3-thiophen-2-ylpropan-2-amine (PubChem CID 105373823) has the molecular formula C17H22FNS and a molecular weight of 291.43 g/mol. Its IUPAC name is 1-(5-fluoro-2-methylphenyl)-N-propyl-3-thiophen-2-ylpropan-2-amine.
| Compound Name | 1-(5-fluoro-2-methylphenyl)-N-propyl-3-thiophen-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 105373823 |
| Molecular Formula | C17H22FNS |
| Molecular Weight | 291.43 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 1-(5-fluoro-2-methylphenyl)-N-propyl-3-thiophen-2-ylpropan-2-amine |
| SMILES | CCCNC(Cc1cccs1)Cc1cc(F)ccc1C |
| InChI | InChI=1S/C17H22FNS/c1-3-8-19-16(12-17-5-4-9-20-17)11-14-10-15(18)7-6-13(14)2/h4-7,9-10,16,19H,3,8,11-12H2,1-2H3 |
| InChIKey | AECINQDPVGHDJM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |