C15H14BrClFN — CID 105374267
1-(3-bromo-4-chlorophenyl)-2-(5-fluoro-2-methylphenyl)ethanamine (PubChem CID 105374267) has the molecular formula C15H14BrClFN and a molecular weight of 342.64 g/mol. Its IUPAC name is 1-(3-bromo-4-chlorophenyl)-2-(5-fluoro-2-methylphenyl)ethanamine.
| Compound Name | 1-(3-bromo-4-chlorophenyl)-2-(5-fluoro-2-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 105374267 |
| Molecular Formula | C15H14BrClFN |
| Molecular Weight | 342.64 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | 1-(3-bromo-4-chlorophenyl)-2-(5-fluoro-2-methylphenyl)ethanamine |
| SMILES | Cc1ccc(F)cc1CC(N)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C15H14BrClFN/c1-9-2-4-12(18)6-11(9)8-15(19)10-3-5-14(17)13(16)7-10/h2-7,15H,8,19H2,1H3 |
| InChIKey | QGSIZHFGRSZDOV-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.64 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |