C15H18O2 — CID 10537444
(6aR,9aR,9bR)-3,6-dimethyl-9-methylidene-4,6a,7,8,9a,9b-hexahydroazuleno[4,5-b]furan-2-one (PubChem CID 10537444) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is (6aR,9aR,9bR)-3,6-dimethyl-9-methylidene-4,6a,7,8,9a,9b-hexahydroazuleno[4,5-b]furan-2-one.
| Compound Name | (6aR,9aR,9bR)-3,6-dimethyl-9-methylidene-4,6a,7,8,9a,9b-hexahydroazuleno[4,5-b]furan-2-one |
|---|---|
| PubChem CID | 10537444 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (6aR,9aR,9bR)-3,6-dimethyl-9-methylidene-4,6a,7,8,9a,9b-hexahydroazuleno[4,5-b]furan-2-one |
| SMILES | C=C1CC[C@H]2C(C)=CCC3=C(C)C(=O)O[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C15H18O2/c1-8-4-7-12-10(3)15(16)17-14(12)13-9(2)5-6-11(8)13/h4,11,13-14H,2,5-7H2,1,3H3/t11-,13-,14-/m0/s1 |
| InChIKey | AUQBJGRMIQTFBR-UBHSHLNASA-N |
| XLogP | 3.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|