About 1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine]
1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine] (PubChem CID 10537503) has the molecular formula C15H21NO
and a molecular weight of 231.34 g/mol. Its IUPAC name is 1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine].
Molecular Properties
| Compound Name | 1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine] |
| PubChem CID | 10537503 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine] |
| SMILES | CCCN1CCCC12COc1ccccc1C2 |
| InChI | InChI=1S/C15H21NO/c1-2-9-16-10-5-8-15(16)11-13-6-3-4-7-14(13)17-12-15/h3-4,6-7H,2,5,8-12H2,1H3 |
| InChIKey | KVWQUSCIHSGNTO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine]?
The IUPAC name of 1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine] (CID 10537503) is 1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine].
What is the SMILES notation for 1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine]?
The canonical SMILES for 1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine] is CCCN1CCCC12COc1ccccc1C2.
What is the InChIKey of 1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine]?
The InChIKey is KVWQUSCIHSGNTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO/c1-2-9-16-10-5-8-15(16)11-13-6-3-4-7-14(13)17-12-15/h3-4,6-7H,2,5,8-12H2,1H3.
What are the key properties of 1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine]?
1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine] has a molecular weight of 231.34 g/mol, XLogP of 2.87, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine] is sourced from PubChem (CID 10537503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).