C13H15FN4O — CID 105376615
1-[1-(2-aminoethyl)triazol-4-yl]-2-(5-fluoro-2-methylphenyl)ethanone (PubChem CID 105376615) has the molecular formula C13H15FN4O and a molecular weight of 262.29 g/mol. Its IUPAC name is 1-[1-(2-aminoethyl)triazol-4-yl]-2-(5-fluoro-2-methylphenyl)ethanone.
| Compound Name | 1-[1-(2-aminoethyl)triazol-4-yl]-2-(5-fluoro-2-methylphenyl)ethanone |
|---|---|
| PubChem CID | 105376615 |
| Molecular Formula | C13H15FN4O |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 1-[1-(2-aminoethyl)triazol-4-yl]-2-(5-fluoro-2-methylphenyl)ethanone |
| SMILES | Cc1ccc(F)cc1CC(=O)c1cn(CCN)nn1 |
| InChI | InChI=1S/C13H15FN4O/c1-9-2-3-11(14)6-10(9)7-13(19)12-8-18(5-4-15)17-16-12/h2-3,6,8H,4-5,7,15H2,1H3 |
| InChIKey | HQVGKOLKZCXHAX-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |