C15H22O2 — CID 10537672
(1R,2R,5S,8R)-2,5,9,9-tetramethyltricyclo[6.3.0.01,5]undecane-3,7-dione (PubChem CID 10537672) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (1R,2R,5S,8R)-2,5,9,9-tetramethyltricyclo[6.3.0.01,5]undecane-3,7-dione.
| Compound Name | (1R,2R,5S,8R)-2,5,9,9-tetramethyltricyclo[6.3.0.01,5]undecane-3,7-dione |
|---|---|
| PubChem CID | 10537672 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (1R,2R,5S,8R)-2,5,9,9-tetramethyltricyclo[6.3.0.01,5]undecane-3,7-dione |
| SMILES | C[C@H]1C(=O)C[C@@]2(C)CC(=O)[C@@H]3C(C)(C)CC[C@]312 |
| InChI | InChI=1S/C15H22O2/c1-9-10(16)7-14(4)8-11(17)12-13(2,3)5-6-15(9,12)14/h9,12H,5-8H2,1-4H3/t9-,12+,14-,15+/m0/s1 |
| InChIKey | KWFOSDWZJVVCMS-VFGSGVCASA-N |
| XLogP | 3.00 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |