C10H22NO3P — CID 10537710
N-butyl-N,5,5-trimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-amine (PubChem CID 10537710) has the molecular formula C10H22NO3P and a molecular weight of 235.26 g/mol. Its IUPAC name is N-butyl-N,5,5-trimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-amine.
| Compound Name | N-butyl-N,5,5-trimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-amine |
|---|---|
| PubChem CID | 10537710 |
| Molecular Formula | C10H22NO3P |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | N-butyl-N,5,5-trimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-amine |
| SMILES | CCCCN(C)P1(=O)OCC(C)(C)CO1 |
| InChI | InChI=1S/C10H22NO3P/c1-5-6-7-11(4)15(12)13-8-10(2,3)9-14-15/h5-9H2,1-4H3 |
| InChIKey | UAAWSOHUKNORPG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|