About N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylbutanamide
N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylbutanamide (PubChem CID 10537725) has the molecular formula C14H21NO2
and a molecular weight of 235.33 g/mol. Its IUPAC name is N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylbutanamide.
Molecular Properties
| Compound Name | N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylbutanamide |
| PubChem CID | 10537725 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylbutanamide |
| SMILES | CCCC(=O)N(C)[C@@H](C)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C14H21NO2/c1-4-8-13(16)15(3)11(2)14(17)12-9-6-5-7-10-12/h5-7,9-11,14,17H,4,8H2,1-3H3/t11-,14+/m0/s1 |
| InChIKey | LNGNWIKSPQYEPK-SMDDNHRTSA-N |
| XLogP | 2.37 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylbutanamide?
The IUPAC name of N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylbutanamide (CID 10537725) is N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylbutanamide.
What is the SMILES notation for N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylbutanamide?
The canonical SMILES for N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylbutanamide is CCCC(=O)N(C)[C@@H](C)[C@@H](O)c1ccccc1.
What is the InChIKey of N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylbutanamide?
The InChIKey is LNGNWIKSPQYEPK-SMDDNHRTSA-N. The full InChI is InChI=1S/C14H21NO2/c1-4-8-13(16)15(3)11(2)14(17)12-9-6-5-7-10-12/h5-7,9-11,14,17H,4,8H2,1-3H3/t11-,14+/m0/s1.
What are the key properties of N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylbutanamide?
N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylbutanamide has a molecular weight of 235.33 g/mol, XLogP of 2.37, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylbutanamide is sourced from PubChem (CID 10537725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).