About N-[(2E)-3,7-dimethylocta-2,6-dienyl]cyclohexanamine
N-[(2E)-3,7-dimethylocta-2,6-dienyl]cyclohexanamine (PubChem CID 10537737) has the molecular formula C16H29N
and a molecular weight of 235.41 g/mol. Its IUPAC name is N-[(2E)-3,7-dimethylocta-2,6-dienyl]cyclohexanamine.
Molecular Properties
| Compound Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]cyclohexanamine |
| PubChem CID | 10537737 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]cyclohexanamine |
| SMILES | CC(C)=CCC/C(C)=C/CNC1CCCCC1 |
| InChI | InChI=1S/C16H29N/c1-14(2)8-7-9-15(3)12-13-17-16-10-5-4-6-11-16/h8,12,16-17H,4-7,9-11,13H2,1-3H3/b15-12+ |
| InChIKey | MDDPCRWYJNHUFS-NTCAYCPXSA-N |
| XLogP | 4.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2E)-3,7-dimethylocta-2,6-dienyl]cyclohexanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2E)-3,7-dimethylocta-2,6-dienyl]cyclohexanamine?
The IUPAC name of N-[(2E)-3,7-dimethylocta-2,6-dienyl]cyclohexanamine (CID 10537737) is N-[(2E)-3,7-dimethylocta-2,6-dienyl]cyclohexanamine.
What is the SMILES notation for N-[(2E)-3,7-dimethylocta-2,6-dienyl]cyclohexanamine?
The canonical SMILES for N-[(2E)-3,7-dimethylocta-2,6-dienyl]cyclohexanamine is CC(C)=CCC/C(C)=C/CNC1CCCCC1.
What is the InChIKey of N-[(2E)-3,7-dimethylocta-2,6-dienyl]cyclohexanamine?
The InChIKey is MDDPCRWYJNHUFS-NTCAYCPXSA-N. The full InChI is InChI=1S/C16H29N/c1-14(2)8-7-9-15(3)12-13-17-16-10-5-4-6-11-16/h8,12,16-17H,4-7,9-11,13H2,1-3H3/b15-12+.
What are the key properties of N-[(2E)-3,7-dimethylocta-2,6-dienyl]cyclohexanamine?
N-[(2E)-3,7-dimethylocta-2,6-dienyl]cyclohexanamine has a molecular weight of 235.41 g/mol, XLogP of 4.60, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2E)-3,7-dimethylocta-2,6-dienyl]cyclohexanamine is sourced from PubChem (CID 10537737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).