C15H24O2 — CID 10537810
methyl (3aS,7R,7aR)-4-methyl-7-propan-2-yl-2,3,3a,6,7,7a-hexahydro-1H-indene-1-carboxylate (PubChem CID 10537810) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is methyl (3aS,7R,7aR)-4-methyl-7-propan-2-yl-2,3,3a,6,7,7a-hexahydro-1H-indene-1-carboxylate.
| Compound Name | methyl (3aS,7R,7aR)-4-methyl-7-propan-2-yl-2,3,3a,6,7,7a-hexahydro-1H-indene-1-carboxylate |
|---|---|
| PubChem CID | 10537810 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | methyl (3aS,7R,7aR)-4-methyl-7-propan-2-yl-2,3,3a,6,7,7a-hexahydro-1H-indene-1-carboxylate |
| SMILES | COC(=O)C1CC[C@@H]2C(C)=CC[C@H](C(C)C)[C@@H]12 |
| InChI | InChI=1S/C15H24O2/c1-9(2)11-6-5-10(3)12-7-8-13(14(11)12)15(16)17-4/h5,9,11-14H,6-8H2,1-4H3/t11-,12-,13?,14-/m1/s1 |
| InChIKey | XIDCFAPMRXWHDZ-MVWAYNQESA-N |
| XLogP | 3.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|