About ethyl (2S)-3,3,3-trifluoro-2-hydroxy-2-(1H-pyrrol-2-yl)propanoate
ethyl (2S)-3,3,3-trifluoro-2-hydroxy-2-(1H-pyrrol-2-yl)propanoate (PubChem CID 10537824) has the molecular formula C9H10F3NO3
and a molecular weight of 237.18 g/mol. Its IUPAC name is ethyl (2S)-3,3,3-trifluoro-2-hydroxy-2-(1H-pyrrol-2-yl)propanoate.
Molecular Properties
| Compound Name | ethyl (2S)-3,3,3-trifluoro-2-hydroxy-2-(1H-pyrrol-2-yl)propanoate |
| PubChem CID | 10537824 |
| Molecular Formula | C9H10F3NO3 |
| Molecular Weight | 237.18 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | ethyl (2S)-3,3,3-trifluoro-2-hydroxy-2-(1H-pyrrol-2-yl)propanoate |
| SMILES | CCOC(=O)[C@@](O)(c1ccc[nH]1)C(F)(F)F |
| InChI | InChI=1S/C9H10F3NO3/c1-2-16-7(14)8(15,9(10,11)12)6-4-3-5-13-6/h3-5,13,15H,2H2,1H3/t8-/m0/s1 |
| InChIKey | ZOQFCCWJBVOJKD-QMMMGPOBSA-N |
| XLogP | 1.33 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.18 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl (2S)-3,3,3-trifluoro-2-hydroxy-2-(1H-pyrrol-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2S)-3,3,3-trifluoro-2-hydroxy-2-(1H-pyrrol-2-yl)propanoate?
The IUPAC name of ethyl (2S)-3,3,3-trifluoro-2-hydroxy-2-(1H-pyrrol-2-yl)propanoate (CID 10537824) is ethyl (2S)-3,3,3-trifluoro-2-hydroxy-2-(1H-pyrrol-2-yl)propanoate.
What is the SMILES notation for ethyl (2S)-3,3,3-trifluoro-2-hydroxy-2-(1H-pyrrol-2-yl)propanoate?
The canonical SMILES for ethyl (2S)-3,3,3-trifluoro-2-hydroxy-2-(1H-pyrrol-2-yl)propanoate is CCOC(=O)[C@@](O)(c1ccc[nH]1)C(F)(F)F.
What is the InChIKey of ethyl (2S)-3,3,3-trifluoro-2-hydroxy-2-(1H-pyrrol-2-yl)propanoate?
The InChIKey is ZOQFCCWJBVOJKD-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H10F3NO3/c1-2-16-7(14)8(15,9(10,11)12)6-4-3-5-13-6/h3-5,13,15H,2H2,1H3/t8-/m0/s1.
What are the key properties of ethyl (2S)-3,3,3-trifluoro-2-hydroxy-2-(1H-pyrrol-2-yl)propanoate?
ethyl (2S)-3,3,3-trifluoro-2-hydroxy-2-(1H-pyrrol-2-yl)propanoate has a molecular weight of 237.18 g/mol, XLogP of 1.33, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2S)-3,3,3-trifluoro-2-hydroxy-2-(1H-pyrrol-2-yl)propanoate is sourced from PubChem (CID 10537824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).