C14H15F3N2 — CID 105378460
3,3,3-trifluoro-N-[(2-methylquinolin-6-yl)methyl]propan-1-amine (PubChem CID 105378460) has the molecular formula C14H15F3N2 and a molecular weight of 268.28 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-[(2-methylquinolin-6-yl)methyl]propan-1-amine.
| Compound Name | 3,3,3-trifluoro-N-[(2-methylquinolin-6-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 105378460 |
| Molecular Formula | C14H15F3N2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 3,3,3-trifluoro-N-[(2-methylquinolin-6-yl)methyl]propan-1-amine |
| SMILES | Cc1ccc2cc(CNCCC(F)(F)F)ccc2n1 |
| InChI | InChI=1S/C14H15F3N2/c1-10-2-4-12-8-11(3-5-13(12)19-10)9-18-7-6-14(15,16)17/h2-5,8,18H,6-7,9H2,1H3 |
| InChIKey | IUQPJCCSBFWEHR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|