C17H22N2S — CID 105378694
N-[(2-methylquinolin-6-yl)methyl]-1-(thian-4-yl)methanamine (PubChem CID 105378694) has the molecular formula C17H22N2S and a molecular weight of 286.44 g/mol. Its IUPAC name is N-[(2-methylquinolin-6-yl)methyl]-1-(thian-4-yl)methanamine.
| Compound Name | N-[(2-methylquinolin-6-yl)methyl]-1-(thian-4-yl)methanamine |
|---|---|
| PubChem CID | 105378694 |
| Molecular Formula | C17H22N2S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | N-[(2-methylquinolin-6-yl)methyl]-1-(thian-4-yl)methanamine |
| SMILES | Cc1ccc2cc(CNCC3CCSCC3)ccc2n1 |
| InChI | InChI=1S/C17H22N2S/c1-13-2-4-16-10-15(3-5-17(16)19-13)12-18-11-14-6-8-20-9-7-14/h2-5,10,14,18H,6-9,11-12H2,1H3 |
| InChIKey | RKALLDARUOZYJU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |