C12H14O5 — CID 10537881
(1R,2S,4S,5R)-1,5-dimethoxy-6-oxobicyclo[2.2.2]oct-7-ene-2,5-dicarbaldehyde (PubChem CID 10537881) has the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. Its IUPAC name is (1R,2S,4S,5R)-1,5-dimethoxy-6-oxobicyclo[2.2.2]oct-7-ene-2,5-dicarbaldehyde.
| Compound Name | (1R,2S,4S,5R)-1,5-dimethoxy-6-oxobicyclo[2.2.2]oct-7-ene-2,5-dicarbaldehyde |
|---|---|
| PubChem CID | 10537881 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | (1R,2S,4S,5R)-1,5-dimethoxy-6-oxobicyclo[2.2.2]oct-7-ene-2,5-dicarbaldehyde |
| SMILES | CO[C@]12C=C[C@H](C[C@@H]1C=O)[C@](C=O)(OC)C2=O |
| InChI | InChI=1S/C12H14O5/c1-16-11-4-3-8(5-9(11)6-13)12(7-14,17-2)10(11)15/h3-4,6-9H,5H2,1-2H3/t8-,9-,11-,12+/m1/s1 |
| InChIKey | FMULWOZSAIPYJX-IQIPOGNMSA-N |
| XLogP | -0.07 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|