C17H25N3O — CID 105378829
N-(2-ethoxyethyl)-N-methyl-1-(2-methylquinolin-6-yl)ethane-1,2-diamine (PubChem CID 105378829) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-N-methyl-1-(2-methylquinolin-6-yl)ethane-1,2-diamine.
| Compound Name | N-(2-ethoxyethyl)-N-methyl-1-(2-methylquinolin-6-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 105378829 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | N-(2-ethoxyethyl)-N-methyl-1-(2-methylquinolin-6-yl)ethane-1,2-diamine |
| SMILES | CCOCCN(C)C(CN)c1ccc2nc(C)ccc2c1 |
| InChI | InChI=1S/C17H25N3O/c1-4-21-10-9-20(3)17(12-18)15-7-8-16-14(11-15)6-5-13(2)19-16/h5-8,11,17H,4,9-10,12,18H2,1-3H3 |
| InChIKey | DUCDVZJQQJFKMT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|