C12H11FO2S — CID 10537890
4-(4-fluorophenyl)sulfanyl-5,5-dimethylfuran-2-one (PubChem CID 10537890) has the molecular formula C12H11FO2S and a molecular weight of 238.28 g/mol. Its IUPAC name is 4-(4-fluorophenyl)sulfanyl-5,5-dimethylfuran-2-one.
| Compound Name | 4-(4-fluorophenyl)sulfanyl-5,5-dimethylfuran-2-one |
|---|---|
| PubChem CID | 10537890 |
| Molecular Formula | C12H11FO2S |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 4-(4-fluorophenyl)sulfanyl-5,5-dimethylfuran-2-one |
| SMILES | CC1(C)OC(=O)C=C1Sc1ccc(F)cc1 |
| InChI | InChI=1S/C12H11FO2S/c1-12(2)10(7-11(14)15-12)16-9-5-3-8(13)4-6-9/h3-7H,1-2H3 |
| InChIKey | BVXJDROJMFCOCO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |