C17H17NOS — CID 105379193
1-(2-methylquinolin-6-yl)-3-thiophen-3-ylpropan-1-ol (PubChem CID 105379193) has the molecular formula C17H17NOS and a molecular weight of 283.40 g/mol. Its IUPAC name is 1-(2-methylquinolin-6-yl)-3-thiophen-3-ylpropan-1-ol.
| Compound Name | 1-(2-methylquinolin-6-yl)-3-thiophen-3-ylpropan-1-ol |
|---|---|
| PubChem CID | 105379193 |
| Molecular Formula | C17H17NOS |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 1-(2-methylquinolin-6-yl)-3-thiophen-3-ylpropan-1-ol |
| SMILES | Cc1ccc2cc(C(O)CCc3ccsc3)ccc2n1 |
| InChI | InChI=1S/C17H17NOS/c1-12-2-4-14-10-15(5-6-16(14)18-12)17(19)7-3-13-8-9-20-11-13/h2,4-6,8-11,17,19H,3,7H2,1H3 |
| InChIKey | SWDFLEDIIPVQEK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |