About (4-bromoanilino) thiohypochlorite
(4-bromoanilino) thiohypochlorite (PubChem CID 10537931) has the molecular formula C6H5BrClNS
and a molecular weight of 238.54 g/mol. Its IUPAC name is (4-bromoanilino) thiohypochlorite.
Molecular Properties
| Compound Name | (4-bromoanilino) thiohypochlorite |
| PubChem CID | 10537931 |
| Molecular Formula | C6H5BrClNS |
| Molecular Weight | 238.54 g/mol |
| Exact Mass | 236.90 |
| IUPAC Name | (4-bromoanilino) thiohypochlorite |
| SMILES | ClSNc1ccc(Br)cc1 |
| InChI | InChI=1S/C6H5BrClNS/c7-5-1-3-6(4-2-5)9-10-8/h1-4,9H |
| InChIKey | OGVKMSCLRMEMBV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-bromoanilino) thiohypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromoanilino) thiohypochlorite?
The IUPAC name of (4-bromoanilino) thiohypochlorite (CID 10537931) is (4-bromoanilino) thiohypochlorite.
What is the SMILES notation for (4-bromoanilino) thiohypochlorite?
The canonical SMILES for (4-bromoanilino) thiohypochlorite is ClSNc1ccc(Br)cc1.
What is the InChIKey of (4-bromoanilino) thiohypochlorite?
The InChIKey is OGVKMSCLRMEMBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BrClNS/c7-5-1-3-6(4-2-5)9-10-8/h1-4,9H.
What are the key properties of (4-bromoanilino) thiohypochlorite?
(4-bromoanilino) thiohypochlorite has a molecular weight of 238.54 g/mol, XLogP of 3.66, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromoanilino) thiohypochlorite is sourced from PubChem (CID 10537931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).