C15H16N4 — CID 105379314
2,3-dimethyl-5-(2-methylquinolin-6-yl)imidazol-4-amine (PubChem CID 105379314) has the molecular formula C15H16N4 and a molecular weight of 252.32 g/mol. Its IUPAC name is 2,3-dimethyl-5-(2-methylquinolin-6-yl)imidazol-4-amine.
| Compound Name | 2,3-dimethyl-5-(2-methylquinolin-6-yl)imidazol-4-amine |
|---|---|
| PubChem CID | 105379314 |
| Molecular Formula | C15H16N4 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2,3-dimethyl-5-(2-methylquinolin-6-yl)imidazol-4-amine |
| SMILES | Cc1ccc2cc(-c3nc(C)n(C)c3N)ccc2n1 |
| InChI | InChI=1S/C15H16N4/c1-9-4-5-11-8-12(6-7-13(11)17-9)14-15(16)19(3)10(2)18-14/h4-8H,16H2,1-3H3 |
| InChIKey | JDUCSPZFUOKVBP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |