About 6-bromo-4,4-dimethyl-2,3-dihydro-1H-naphthalene
6-bromo-4,4-dimethyl-2,3-dihydro-1H-naphthalene (PubChem CID 10537940) has the molecular formula C12H15Br
and a molecular weight of 239.16 g/mol. Its IUPAC name is 6-bromo-4,4-dimethyl-2,3-dihydro-1H-naphthalene.
Molecular Properties
| Compound Name | 6-bromo-4,4-dimethyl-2,3-dihydro-1H-naphthalene |
| PubChem CID | 10537940 |
| Molecular Formula | C12H15Br |
| Molecular Weight | 239.16 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 6-bromo-4,4-dimethyl-2,3-dihydro-1H-naphthalene |
| SMILES | CC1(C)CCCc2ccc(Br)cc21 |
| InChI | InChI=1S/C12H15Br/c1-12(2)7-3-4-9-5-6-10(13)8-11(9)12/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | VUAGQOMMVXBEDN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.16 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 6-bromo-4,4-dimethyl-2,3-dihydro-1H-naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4,4-dimethyl-2,3-dihydro-1H-naphthalene?
The IUPAC name of 6-bromo-4,4-dimethyl-2,3-dihydro-1H-naphthalene (CID 10537940) is 6-bromo-4,4-dimethyl-2,3-dihydro-1H-naphthalene.
What is the SMILES notation for 6-bromo-4,4-dimethyl-2,3-dihydro-1H-naphthalene?
The canonical SMILES for 6-bromo-4,4-dimethyl-2,3-dihydro-1H-naphthalene is CC1(C)CCCc2ccc(Br)cc21.
What is the InChIKey of 6-bromo-4,4-dimethyl-2,3-dihydro-1H-naphthalene?
The InChIKey is VUAGQOMMVXBEDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15Br/c1-12(2)7-3-4-9-5-6-10(13)8-11(9)12/h5-6,8H,3-4,7H2,1-2H3.
What are the key properties of 6-bromo-4,4-dimethyl-2,3-dihydro-1H-naphthalene?
6-bromo-4,4-dimethyl-2,3-dihydro-1H-naphthalene has a molecular weight of 239.16 g/mol, XLogP of 4.06, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4,4-dimethyl-2,3-dihydro-1H-naphthalene is sourced from PubChem (CID 10537940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).