About 3,5-dipyridin-3-yl-1,2,4-thiadiazole
3,5-dipyridin-3-yl-1,2,4-thiadiazole (PubChem CID 10538018) has the molecular formula C12H8N4S
and a molecular weight of 240.29 g/mol. Its IUPAC name is 3,5-dipyridin-3-yl-1,2,4-thiadiazole.
Molecular Properties
| Compound Name | 3,5-dipyridin-3-yl-1,2,4-thiadiazole |
| PubChem CID | 10538018 |
| Molecular Formula | C12H8N4S |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 3,5-dipyridin-3-yl-1,2,4-thiadiazole |
| SMILES | c1cncc(-c2nsc(-c3cccnc3)n2)c1 |
| InChI | InChI=1S/C12H8N4S/c1-3-9(7-13-5-1)11-15-12(17-16-11)10-4-2-6-14-8-10/h1-8H |
| InChIKey | PJSNUISYDHNJTG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,5-dipyridin-3-yl-1,2,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dipyridin-3-yl-1,2,4-thiadiazole?
The IUPAC name of 3,5-dipyridin-3-yl-1,2,4-thiadiazole (CID 10538018) is 3,5-dipyridin-3-yl-1,2,4-thiadiazole.
What is the SMILES notation for 3,5-dipyridin-3-yl-1,2,4-thiadiazole?
The canonical SMILES for 3,5-dipyridin-3-yl-1,2,4-thiadiazole is c1cncc(-c2nsc(-c3cccnc3)n2)c1.
What is the InChIKey of 3,5-dipyridin-3-yl-1,2,4-thiadiazole?
The InChIKey is PJSNUISYDHNJTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N4S/c1-3-9(7-13-5-1)11-15-12(17-16-11)10-4-2-6-14-8-10/h1-8H.
What are the key properties of 3,5-dipyridin-3-yl-1,2,4-thiadiazole?
3,5-dipyridin-3-yl-1,2,4-thiadiazole has a molecular weight of 240.29 g/mol, XLogP of 2.66, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dipyridin-3-yl-1,2,4-thiadiazole is sourced from PubChem (CID 10538018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).