C13H20O4 — CID 10538020
(1S,6R,9S,12S)-9-ethenyl-12-methoxy-10,11,13-trioxatricyclo[7.2.2.01,6]tridecane (PubChem CID 10538020) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is (1S,6R,9S,12S)-9-ethenyl-12-methoxy-10,11,13-trioxatricyclo[7.2.2.01,6]tridecane.
| Compound Name | (1S,6R,9S,12S)-9-ethenyl-12-methoxy-10,11,13-trioxatricyclo[7.2.2.01,6]tridecane |
|---|---|
| PubChem CID | 10538020 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | (1S,6R,9S,12S)-9-ethenyl-12-methoxy-10,11,13-trioxatricyclo[7.2.2.01,6]tridecane |
| SMILES | C=C[C@]12CC[C@H]3CCCC[C@@]3(OO1)[C@@H](OC)O2 |
| InChI | InChI=1S/C13H20O4/c1-3-12-9-7-10-6-4-5-8-13(10,17-16-12)11(14-2)15-12/h3,10-11H,1,4-9H2,2H3/t10-,11+,12-,13+/m1/s1 |
| InChIKey | IEVDJNZPWUJGLT-XQHKEYJVSA-N |
| XLogP | 2.54 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|