C14H19F2N3O — CID 105380732
2,3-difluoro-N-(1-propan-2-ylpiperidin-4-yl)pyridine-4-carboxamide (PubChem CID 105380732) has the molecular formula C14H19F2N3O and a molecular weight of 283.32 g/mol. Its IUPAC name is 2,3-difluoro-N-(1-propan-2-ylpiperidin-4-yl)pyridine-4-carboxamide.
| Compound Name | 2,3-difluoro-N-(1-propan-2-ylpiperidin-4-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105380732 |
| Molecular Formula | C14H19F2N3O |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 2,3-difluoro-N-(1-propan-2-ylpiperidin-4-yl)pyridine-4-carboxamide |
| SMILES | CC(C)N1CCC(NC(=O)c2ccnc(F)c2F)CC1 |
| InChI | InChI=1S/C14H19F2N3O/c1-9(2)19-7-4-10(5-8-19)18-14(20)11-3-6-17-13(16)12(11)15/h3,6,9-10H,4-5,7-8H2,1-2H3,(H,18,20) |
| InChIKey | RVLIJBZKIVTVSH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|