C14H14N2O2 — CID 10538108
(1R,12S)-3-acetyl-4-methyl-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-trien-7-one (PubChem CID 10538108) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is (1R,12S)-3-acetyl-4-methyl-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-trien-7-one.
| Compound Name | (1R,12S)-3-acetyl-4-methyl-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-trien-7-one |
|---|---|
| PubChem CID | 10538108 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | (1R,12S)-3-acetyl-4-methyl-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-trien-7-one |
| SMILES | CC(=O)c1c(C)[nH]c2c1[C@@]13C[C@@H]1CNC3=CC2=O |
| InChI | InChI=1S/C14H14N2O2/c1-6-11(7(2)17)12-13(16-6)9(18)3-10-14(12)4-8(14)5-15-10/h3,8,15-16H,4-5H2,1-2H3/t8-,14+/m1/s1 |
| InChIKey | FLRHYRZIGZGCJC-CLAHSXSESA-N |
| XLogP | 1.47 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |