C14H13FN2O2 — CID 105381797
3-fluoro-2-(2-phenylethylamino)pyridine-4-carboxylic acid (PubChem CID 105381797) has the molecular formula C14H13FN2O2 and a molecular weight of 260.27 g/mol. Its IUPAC name is 3-fluoro-2-(2-phenylethylamino)pyridine-4-carboxylic acid.
| Compound Name | 3-fluoro-2-(2-phenylethylamino)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 105381797 |
| Molecular Formula | C14H13FN2O2 |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 3-fluoro-2-(2-phenylethylamino)pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(NCCc2ccccc2)c1F |
| InChI | InChI=1S/C14H13FN2O2/c15-12-11(14(18)19)7-9-17-13(12)16-8-6-10-4-2-1-3-5-10/h1-5,7,9H,6,8H2,(H,16,17)(H,18,19) |
| InChIKey | RMDJKHZQXRLVTA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |